Chapter 15: Organic Compounds and the Atomic Properties of Carbon

Homework:8,9,15,20,21,24,25,30,31,36,43,44,47,48,51,60,61,69,70,76,83,85,87,97,104,105

Organic chemistry originally thought of as the chemistry of substances that came from living things, and that organic chemicals were imparted with an innate  ‘vital force’.  The fall of the vital force theory came when urea, a simple organic substance, was synthesized from nonliving material.

 CO2 +  2 NH3 à NH2CONH2  +  H2O

Organic chemistry is now defined as the study of carbon-based compounds and their reactions. 

Critical Knowledge

Number of bonds for elements in organic molecules:

 C = 4,   N = 3, O = 2, H = 1, Halogen = 1

Hybridization     bonding              electron distribution    bond angle
         sp3         single bonds          tetrahedral                  109.5
         sp2         double bond          trigonal planar            120
         sp          triple bond             linear                         180

Hydrocarbons:  Alkanes and Cycloalkanes

Nomenclature

CH4                                                             Methane          CH4

CH3CH3                                                       Ethane            C2H6

CH3CH2CH3                                                Propane          C3H8

CH3CH2CH2 CH3                                         Butane            C4H10       CH3(CH2)2CH3

CH3CH2CH2 CH2 CH3                                 Pentane           C5H12       CH3(CH2)3CH3

CH3CH2CH2 CH2 CH2 CH3                          Hexane           C6H14       CH3(CH2)4CH3

CH3CH2CH2 CH2 CH2 CH2 CH3                   Heptane          C7H16       CH3(CH2)5CH3

CH3CH2CH2 CH2 CH2 CH2 CH2 CH3           Octane            C8H18       CH3(CH2)6CH3

CH3CH2CH2CH2CH2CH2CH2CH2CH3          Nnonane         C9H20       CH3(CH2)7CH3

CH3CH2CH2CH2CH2CH2CH2CH2CH2CH3   Decane           C10H22          CH3(CH2)8CH3

Substituent Groups

CH3-                                               Methyl                 Cl-            Chloro

CH3CH2                                       Ethyl                    Br-            Bromo

CH3CH2CH3                                   Propyl                 I-              Iodo

CH3CH2CH2 CH2                          Butyl                    F-             fluoro

CH3CH2CH2 CH2 CH2-                   Pentyl                  -NO2         Nitro

CH3CH2CH2 CH2 CH2 CH2-            Hexyl                                   

Consider the following molecule and name it using the following procedures.

3,3,4-tribromo-6-chloro-2-methyloctane

    1 When naming a hydrocarbon, you find the longest continuous carbon chain and number it giving the lowest possible numbers to the substituent groups. This longest chain is called the parent molecule.

2        Give the name of substituent groups in alphabetic order giving the number of the carbon that EACH substituent group is attached to, and indicate the number of EACH type of substituent by using the prefixes:  di, tri, tetra, penta, hexa, hepta, octa, nona, deca etc.  Commas go between numbers and dashes go between numbers and words. Try these:

 

 

3    When hydrocarbons are cyclic, that is the ends are attached to form a closed carbon ring, the prefix cyclo- is given to the parent hydrocarbon. Numbers are given to give the lowest possible numbers to the substituents.               

                                 

Problem 1: What is the general formula for linear alkanes. What is the general formula for cyclic alkanes.

Problem 2: Give all the possible straight chain alkane isomers for C6H14 and name each.

Problem 3: Give all the possible cycloalkane isomers for C6H12 and name each.

Alkenes

Alkenes are hydrocarbons having carbon-carbon double bonds.

CH2=CH2                                Ethene                          

CH2=CHCH3                           Propene                        

CH2=CHCH2CH3                    1-Butene

CH3CH=CHCH3                      2-Butene

CH2=CHCH2CH2CH3              1-Pentene

CH3CH=CHCH2CH3               2-Pentene

CH2=CHCH2CH2CH2CH3         1-Hexene    

CH3CH=CHCH2CH2CH3         2-Hexene                      

CH3CH2CH= CHCH2CH3       3-Hexene    etc.

When naming alkenes the lowest number is given to the double bond in the molecule. Double bonds take precedence over other substituent groups.

Problem 4:  Name the following:

CH3CH2CH=CHCHClCCl2CH2CHClCH3 

CH3CH2CHClC(CH3)ClCCl2CH=CH2  

                 

CH3CH2CH= CHCHClCCl2CH2CCl=CH2  

Since carbon-carbon double bonds can’t rotate, stereoisomerisms (cis-trans) isomers exists. 

                                                                        

Cis-1,2-dichloro ethene                         Trans-1,2-dichloro ethene

Problem 5: Give all possible alkene isomers for C6H12 and name each isomer.

Problem 6: What is the general formula for alkenes?

Problem 7: What is the general formula for a cycloalkene?

Problem 8: What is the general formula for a diene?

Aromatic Hydrocarbons

Aromatic hydrocarbons are cyclic hydrocarbons having alternating double bonds whose number of p-electrons is 4n+2 where n can be 0,1,2,3,4...

 
                 Benzene 

Each  sp2 hybridized carbons has a leftover p-orbital in which 3 pairs of electrons exist above and below the plane of the carbons in a p-bonding network. This p-network delocalizes (spreads out) the electrons thus reducing the energy of the system.  The two resonance forms of benzene are shown above; however, neither is correct since the electron waves are spread out evenly throughout the p-system.

When naming substituted benzenes, the lowest number is given to the substituent group(s), the names of the substituent groups is given in alphabetic order and the name benzene or the particular benzene derivative is given last.

Benzene Derivatives  Ø = C6H5 (Phenyl group)

Ø-OH          Phenol                                      Note: The lowest number is given to

Ø-NH2         Analine                                               the functional group.

Ø-CH3         Toluene

Ø-CHO       Benzaldehyde

Ø-CO2H      Benzoic acid

Problem 9: Name the follwoing:

Another nomenclature that is particular to benzene derivatives is the ortho, para, meta designation.  Ortho indicates the #2 position relative to another substituent group or functional group. Meta indicates the #3 position relative to another substituent group or functional group.  Para indicates the #4 position relative to another substituent group or functional group. When giving this designation o-, p- and m- are used in front of the substituent group’s name.

Problem 10: Give two names for each of the following.

Derivatives of Hydrocarbons: Functional Groups

General Formula               General Class        Example             Example name            

R-X    X= Cl, Br, I, F     Organic halide       CH3CH2-Br           Ethyl bromide

R-OH                            Alcohol                 CH3CH2-OH         Ethanol or Ethyl Alcohol

R-O-R                           Ether                CH3CH2-O-CH2CH3    Diethyl ether

R-COH                          Aldehyde              CH3CH2-COH        Ethanal

R-COR’                        Ketone           CH3CH2-CO-CH2CH3  3-pentanone

R-COOH                       Carboxylic acid     CH3CH2-COOH    Propanoic acid

R-COOR’                     Ester                     CH3COOCH3        Methylacetate

R-NH2, R-N, R-N          Amine                   CH3CH2-NH2        Etylamine

R-CON                          Amide                   CH3CONHCH3     N-methylacetamide

Alcohols

Alcohols are hydrocarbons having an -OH group.  Alcohols have three general classes: Primary 1°, secondary 2° and tertiary 3°.

                                                              

  

Alcohols can be formed by the addition of water across a double bond.  Under the reaction conditions, the -OH group is added to the MOST SUBSTITUTED carbon and the hydrogen is added to the LEAST SUBSTITUTED carbon when there is a choice. This is called Markovnikov's rule.

CH3CH=CH2  +  H2O  +    CH3CHOHCH3   

To add the -OH to the least substituted carbon, anti-Markovnikov, the hydroboration-oxidation method is used.

CH3CH=CH2    CH3CH2CH2OH

Ethers

Ethers have the general formula R-O-R’.  The common nomenclature for ethers consists of alphabetically naming the hydrocarbon groups making up the ether using the -yl ending followed by the word ether.

The IUPAC nomenclature for ethers consists of the root of the shorter hydrocarbon then -oxy- followed by the name of the longest hydrocarbon. 

Problem 11: Name the following ethers using the common nomenclature and IUPAC nomenclature.

CH3OCH2CH3          CH3CH2OCH2CH2CH3        CH3CH2CHBrOCH2CH2CH3 

Ethers as a class tend to be relatively unreactive.  Ethers are prepared by the reaction of sodium with an alcohol to form an alkoxide ion, which is then reacted with another alcohol to produce the ether.

2CH3OH  +  2Na  à  2CH3O-Na+  +  H2

CH3O-  +   CH3CH2OH   à CH3OCH2CH3

Aldehydes

Aldehydes have the general form RCHO with a carbonyl group (-C=O) at the end of the chain.  The nomenclature for aldehydes names the root first followed by -al.

Problem 12: Name the following molecules.

CH3 CH2CHO                     CH3 CHO                        CH3 CH2CH2 CHO

Aldehydes are made by gentle oxidation of 1° alcohols.

CH3 CH2OH  CH3CHO

Ketones

Ketones have a carbonyl group not at the end of a chain. Ketones are made by oxidation of 2° alcohols.

 

The nomenclature for ketones is similar to that of the alcohols but an -one ending is given the ketone.

Problem 13: Name the following molecules.

Carboxylic Acids

Carboxylic acids are organic acids having the general formula RCOOH, and has the structure . Carboxylic acids are formed by the vigorous oxidation of alcohols.

 CH3CH2CH2CH2OH     CH3CH2CH2COOH

The nomenclature for the carboxylic acids is the same as the aldehydes except for the root is followed by -oic acid.

Problem 14: Name the following molecules.

 CH3CH2CH2CH2CH2COOH        CH3COOH             CH3CH2CH2COOH

Esters

Esters are the condensation product of the reaction of alcohols and acids, and have the structure .

CH3CH2CH2COOH  +  CH3CH2OH   CH3CH2CH2COOCH2CH3

Esters are generally sweet smelling molecules with distinct odors. The nomenclature for the esters names the alcohol first followed by the name of the ion of the acid.

Problem 15: Name the following molecules.

 CH3COOCH2CH3            

CH3CH2COOCH2CH3 

CH3CH2COOCH2CH2CH2CH3

Oxidation Reduction Reactions

Alcohols are oxidized to aldehydes and ketones under mild conditions.  Under more strenuous conditions (higher temperature and stronger oxidizing agents) they are oxidized to carboxylic acids.

1° CH3CH2CH2OH   CH3CH2CHO   CH3CH2COOH

     CH3CHOHCH3   CH3COCH3     NR

     (CH3)3COH       NR

Saponification

 Saponification is the making of soap from the treatment of fats and oils with strong base. Glycerol stearate hydrolyzes in base to give glycerol and sodium stearate.  The long chain stearate ion has a hydrophyllic end and a lipophyllic end.  The lipophyllic end dissolves into oils and grease leaving the hydrophyllic end exposed to the water forming a micelle which can be emulsified into the water.

 Organic Compounds Containing Nitrogen

 Amines are classified the same way that alcohols are.

                                                                         

                                     

       N-butyl amine              Ethylmethy amine        trimethyl amine    

Amines are similar to ammonia since they have a free pair of electrons and can readily react with hydronium ion to form ions.

 CH3CH2CH2CH2NH2 +  H+  à  CH3CH2CH2CH2NH3+  butyl ammonium ion

Polymers

Polymer means many unit.  Polymers are formed by several methods.

Addition polymerization occurs when a free radical usually from a peroxide reacts with a double bond to set up a chain reaction.

RO.  +   RCH=CHR’  à  ROCHR-CHR’.

ROCHR-CHR’.  +  nRCH=CHR’   à   RO-(RCH-CHR’)n+1-    

Condensation polymerization occurs when a dicarboxylic acids reacts with either a dialcohol or a diamine giving a polyester or polyamide respectively.

nHOCH2CH2OH + nHOOCCH2CH2CH2COOH à

                                                   -(OCH2CH2OOCCH2CH2CH2CO)-n + 2nH2O

nHOOCCH2CH2COOH + nNH2CH2CH2NH2 à

                                                    -(OCCH2CH2CONHCH2CH2NH)-n +  2nH2O

Problem 16: Show the reaction for the formation of the polyamide nylon-66.

Biological Macromolecules

Sugar Monomers

          

  Glucose        a-pyranose form       b-pyranose form          a-furanose form

Sugar Polymers

 

Amino acid Monomer    

              

  Alanine                  Arginine              Asparagine          Aspartic acid           Cystine

Amino acid Polymers (protein)

 A.K.A.

ala-arg-asn-asp-cys

Nucloetide Monomer


Adenine                                    Guanine                                  Cytosine


      Thiamine

 

Nucleic Acid polymer